| product Name |
2-methoxy-5,5-dimethyl-1,3,2-dioxaphosphorinane |
| Synonyms |
1,3,2-Dioxaphosphorinane, 2-methoxy-5,5-dimethyl-; 2-Methoxy-5,5-dimethyl-1,3,2-dioxaphosphorinane; 2-methoxy-5,5-dimethyl-1,3,2-dioxaphosphinane |
| Molecular Formula |
C6H13O3P |
| Molecular Weight |
164.1394 |
| InChI |
InChI=1/C6H13O3P/c1-6(2)4-8-10(7-3)9-5-6/h4-5H2,1-3H3 |
| CAS Registry Number |
1005-69-2 |
| EINECS |
213-739-0 |
| Molecular Structure |
|
| Boiling point |
140.7°C at 760 mmHg |
| Flash point |
39.2°C |
| Vapour Pressur |
7.58mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|