| product Name |
(3-methylbutyl)cyclopentane |
| Synonyms |
(3-Methylbutyl)cyclopentane; cyclopentane, (3-methylbutyl)-; Cyclopentane, isopentyl- |
| Molecular Formula |
C10H20 |
| Molecular Weight |
140.2658 |
| InChI |
InChI=1/C10H20/c1-9(2)7-8-10-5-3-4-6-10/h9-10H,3-8H2,1-2H3 |
| CAS Registry Number |
1005-68-1 |
| Molecular Structure |
|
| Density |
0.796g/cm3 |
| Boiling point |
173.4°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
47.4°C |
| Vapour Pressur |
1.69mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|