| product Name |
tricyclo[3.3.2.0~2,8~]deca-3,6,9-triene |
| Synonyms |
1005-51-2; Bullvalene; Tricyclo[3.3.2.0~2,8~]deca-3,6,9-triene |
| Molecular Formula |
C10H10 |
| Molecular Weight |
130.1864 |
| InChI |
InChI=1/C10H10/c1-4-8-9-5-2-7(1)3-6-10(8)9/h1-10H |
| CAS Registry Number |
1005-51-2 |
| Molecular Structure |
|
| Density |
1.091g/cm3 |
| Boiling point |
211.3°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
55.8°C |
| Vapour Pressur |
0.267mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|