| product Name |
4,6-Diamino-2-methylmercaptopyrimidine |
| Synonyms |
2-Methylthiopyrimidine-4,6-diamine; 2-(methylsulfanyl)pyrimidine-4,6-diamine |
| Molecular Formula |
C5H8N4S |
| Molecular Weight |
156.2088 |
| InChI |
InChI=1/C5H8N4S/c1-10-5-8-3(6)2-4(7)9-5/h2H,1H3,(H4,6,7,8,9) |
| CAS Registry Number |
1005-39-6 |
| EINECS |
213-735-9 |
| Molecular Structure |
|
| Density |
1.383g/cm3 |
| Boiling point |
413.454°C at 760 mmHg |
| Refractive index |
1.671 |
| Flash point |
203.85°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
