product Name |
4,5-diamino-6-hydroxy-2-mercapto-pyrimidine |
Synonyms |
4,5-Diamino-6-hydroxy-2-mercaptopyrimidine; 4-5-diamino-6-hydroxy-2-*mercaptopyrimidine free; 4,5-diamino-2-mercaptopyrimidine-6-ol; 5,6-Diamino-2-thiouracil; 5,6-diamino-4-hydroxy-2-mercaptopyrimidine; 5,6-diamino-2-mercaptopyrimidin-4-ol; 5,6-diamino-2-thioxo-2,3-dihydropyrimidin-4(1H)-one; 2-Mercapto-4-hydroxy-5,6-diamino-pyrimidine |
Molecular Formula |
C4H6N4OS |
Molecular Weight |
158.1816 |
InChI |
InChI=1/C4H6N4OS/c5-1-2(6)7-4(10)8-3(1)9/h5H2,(H4,6,7,8,9,10) |
CAS Registry Number |
1004-76-8 |
EINECS |
213-727-5 |
Molecular Structure |
|
Density |
1.66g/cm3 |
Melting point |
>300℃ |
Boiling point |
473°C at 760 mmHg |
Refractive index |
1.776 |
Flash point |
239.9°C |
Vapour Pressur |
1.43E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|