| product Name |
2,6-Dimethyl-Gamma-pyrone |
| Synonyms |
2,6-Dimethyl-4H-pyran-4-one; 2,6-Dimethyl-4-pyrone; ; 2,6-Dimethyl-4H-pyran-4-one; 2,6-Dimethyl-gamma-pyrone |
| Molecular Formula |
C7H8O2 |
| Molecular Weight |
124.1372 |
| InChI |
InChI=1/C7H8O2/c1-5-3-7(8)4-6(2)9-5/h3-4H,1-2H3 |
| CAS Registry Number |
1004-36-0 |
| EINECS |
213-719-1 |
| Molecular Structure |
|
| Density |
1.065g/cm3 |
| Melting point |
133-137℃ |
| Boiling point |
249°C at 760 mmHg |
| Refractive index |
1.485 |
| Flash point |
103.4°C |
| Vapour Pressur |
0.0235mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S36/37:;
|
|