| product Name |
2,3,4,5-Tetramethylpyrrole |
| Synonyms |
2,3,4,5-Tetramethyl-1H-pyrrole |
| Molecular Formula |
C8H13N |
| Molecular Weight |
123.1955 |
| InChI |
InChI=1/C8H13N/c1-5-6(2)8(4)9-7(5)3/h9H,1-4H3 |
| CAS Registry Number |
1003-90-3 |
| EINECS |
213-717-0 |
| Molecular Structure |
|
| Density |
0.927g/cm3 |
| Boiling point |
216.2°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
83.1°C |
| Vapour Pressur |
0.208mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
