| product Name |
4-methyloxazole-5-carbonitrile |
| Synonyms |
4-Methyloxazole-5-carbonitrile; 4-methyl-1,3-oxazole-5-carbonitrile |
| Molecular Formula |
C5H4N2O |
| Molecular Weight |
108.0981 |
| InChI |
InChI=1/C5H4N2O/c1-4-5(2-6)8-3-7-4/h3H,1H3 |
| CAS Registry Number |
1003-52-7 |
| EINECS |
213-709-7 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Boiling point |
200.3°C at 760 mmHg |
| Refractive index |
1.488 |
| Flash point |
75°C |
| Vapour Pressur |
0.326mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|