| product Name |
2,5-Dimethyltetrahydrofuran, mixture of cis and trans |
| Molecular Formula |
C6H12O |
| Molecular Weight |
100.1589 |
| InChI |
InChI=1/C6H12O/c1-5-3-4-6(2)7-5/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| CAS Registry Number |
1003-38-9 |
| EINECS |
213-707-6 |
| Molecular Structure |
|
| Density |
0.836g/cm3 |
| Melting point |
-45℃ |
| Boiling point |
91°C at 760 mmHg |
| Refractive index |
1.406 |
| Flash point |
26.7°C |
| Vapour Pressur |
62.1mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
