| product Name |
2-Nitro-4-cymene |
| Synonyms |
2-nitro-para-cymene; 1-methyl-2-nitro-4-(propan-2-yl)benzene |
| Molecular Formula |
C10H13NO2 |
| Molecular Weight |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-7(2)9-5-4-8(3)10(6-9)11(12)13/h4-7H,1-3H3 |
| CAS Registry Number |
943-15-7 |
| EINECS |
213-397-2 |
| Molecular Structure |
|
| Density |
1.069g/cm3 |
| Boiling point |
241.7°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
90.2°C |
| Vapour Pressur |
0.055mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
