| product Name |
2,4-Dimethyl-1,3-pentadiene |
| Synonyms |
2,4-Dimethylpenta-1,3-diene; 1,1,3-Trimethylbutadiene; NSC 123451; 1,3-Pentadiene, 2,4-dimethyl- (8CI)(9CI) |
| Molecular Formula |
C7H12 |
| Molecular Weight |
96.1702 |
| InChI |
InChI=1/C7H12/c1-6(2)5-7(3)4/h5H,1H2,2-4H3 |
| CAS Registry Number |
1000-86-8 |
| EINECS |
213-677-4 |
| Molecular Structure |
|
| Density |
0.726g/cm3 |
| Boiling point |
93.2°C at 760 mmHg |
| Refractive index |
1.426 |
| Flash point |
10°C |
| Vapour Pressur |
56.8mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Codes |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
