| product Name |
Mesitylglyoxylic acid |
| Synonyms |
2,4,6-Trimethylbenzoylformic acid; oxo(2,4,6-trimethylphenyl)acetic acid |
| Molecular Formula |
C11H12O3 |
| Molecular Weight |
192.2112 |
| InChI |
InChI=1/C11H12O3/c1-6-4-7(2)9(8(3)5-6)10(12)11(13)14/h4-5H,1-3H3,(H,13,14) |
| CAS Registry Number |
3112-46-7 |
| Molecular Structure |
|
| Density |
1.169g/cm3 |
| Boiling point |
339.9°C at 760 mmHg |
| Refractive index |
1.549 |
| Flash point |
173.5°C |
| Vapour Pressur |
3.47E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
