product Name |
Cinnamicacid vinylester |
Synonyms |
Cinnamic acid vinyl ester; Vinyl cinnamate, (Cinnamic acid vinyl ester); Vinyl cinnamate; ethenyl 3-phenylprop-2-enoate; ethenyl (2E)-3-phenylprop-2-enoate |
Molecular Formula |
C11H10O2 |
Molecular Weight |
174.1959 |
InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h2-9H,1H2/b9-8+ |
CAS Registry Number |
3098-92-8 |
Molecular Structure |
|
Density |
1.075g/cm3 |
Boiling point |
267°C at 760 mmHg |
Refractive index |
1.566 |
Flash point |
105.9°C |
Vapour Pressur |
0.00836mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|