product Name |
3,5-Dimethyl-4-nitrobenzoic acid |
Synonyms |
- |
Molecular Formula |
C9H9NO4 |
Molecular Weight |
195.1721 |
InChI |
InChI=1/C9H9NO4/c1-5-3-7(9(11)12)4-6(2)8(5)10(13)14/h3-4H,1-2H3,(H,11,12) |
CAS Registry Number |
3095-38-3 |
Molecular Structure |
|
Density |
1.334g/cm3 |
Boiling point |
356.545°C at 760 mmHg |
Refractive index |
1.59 |
Flash point |
157.908°C |
Vapour Pressur |
0mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|