| product Name |
6-Chloro-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline |
| Synonyms |
2,3-quinoxalinediol, 6-chloro-; 2,3-quinoxalinedione, 6-chloro-1,4-dihydro-; 229-647-9; 6-Chloro-1,4-dihydroquinoxaline-2,3-dione; 6-Chloroquinoxaline-2,3-diol |
| Molecular Formula |
C8H5ClN2O2 |
| Molecular Weight |
196.5905 |
| InChI |
InChI=1/C8H5ClN2O2/c9-4-1-2-5-6(3-4)11-8(13)7(12)10-5/h1-3H,(H,10,12)(H,11,13) |
| CAS Registry Number |
169-14-2 |
| EINECS |
229-647-9 |
| Molecular Structure |
|
| Density |
1.475g/cm3 |
| Boiling point |
497.5°C at 760 mmHg |
| Refractive index |
1.601 |
| Flash point |
254.7°C |
| Vapour Pressur |
1.61E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
