| product Name |
alpha-Propyldopacetamide |
| Synonyms |
3,4-Dihydroxy-alpha-propylphenylacetamide; dl-3,4-dihydroxyphenyl-A-*propylacetamide crystal; 2-(3,4-dihydroxyphenyl)pentanamide; (2S)-2-(3,4-dihydroxyphenyl)pentanamide; (2R)-2-(3,4-dihydroxyphenyl)pentanamide |
| Molecular Formula |
C11H15NO3 |
| Molecular Weight |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-2-3-8(11(12)15)7-4-5-9(13)10(14)6-7/h4-6,8,13-14H,2-3H2,1H3,(H2,12,15)/t8-/m1/s1 |
| CAS Registry Number |
154-62-1 |
| EINECS |
205-830-9 |
| Molecular Structure |
|
| Density |
1.229g/cm3 |
| Melting point |
133-135℃ |
| Boiling point |
455.1°C at 760 mmHg |
| Refractive index |
1.584 |
| Flash point |
229°C |
| Vapour Pressur |
6.68E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
