product Name |
5-fluoro-dl-tryptophan |
Molecular Formula |
C11H11FN2O2 |
Molecular Weight |
222.2156 |
InChI |
InChI=1/C11H11FN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
CAS Registry Number |
154-08-5 |
EINECS |
205-822-5 |
Molecular Structure |
|
Density |
1.442g/cm3 |
Melting point |
250℃ |
Boiling point |
450.7°C at 760 mmHg |
Refractive index |
1.673 |
Flash point |
226.4°C |
Vapour Pressur |
6.54E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|