product Name |
N,N,N',N'-Tetraethylethylenediamine |
Synonyms |
1,2-Bis(diethylamino)ethane; N,N,N',N'-tetraethylethane-1,2-diamine; N,N,N',N'-tetraethylethane-1,2-diaminium |
Molecular Formula |
C10H26N2 |
Molecular Weight |
174.3257 |
InChI |
InChI=1/C10H24N2/c1-5-11(6-2)9-10-12(7-3)8-4/h5-10H2,1-4H3/p+2 |
CAS Registry Number |
150-77-6 |
EINECS |
205-770-3 |
Molecular Structure |
|
Boiling point |
190.5°C at 760 mmHg |
Flash point |
58.9°C |
Vapour Pressur |
0.54mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
Safety Description |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|