| product Name |
1,2-Dianilinoethane |
| Synonyms |
N,N-Diphenylethylenediamine~Wanzlicks; Wanzlicks; 1,2-Dianilinoethane, Pract.; N,N-ethylenedianiline; NN-Diphenylethylenediamine; 1,2-Diphenyl Ethanediamine; N,N'-diphenylethane-1,2-diamine; N,N'-diphenylethane-1,2-diaminium |
| Molecular Formula |
C14H16N2 |
| Molecular Weight |
212.2902 |
| InChI |
InChI=1/C14H16N2/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,15H2 |
| CAS Registry Number |
150-61-8 |
| EINECS |
205-765-6 |
| Molecular Structure |
|
| Density |
1.093g/cm3 |
| Melting point |
64-67℃ |
| Boiling point |
351.529°C at 760 mmHg |
| Refractive index |
1.623 |
| Flash point |
148.617°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|