product Name |
meso-tartaric acid hydrate |
Synonyms |
Mesotartaric acid monohydrate; Mesotartaricacid; Tartaric acid, meso, monohydrate; Mesotartaric acid; (2S)-2,3-dihydroxybutanedioic acid; (2R,3S)-2,3-dihydroxybutanedioic acid |
Molecular Formula |
C4H6O6 |
Molecular Weight |
150.0868 |
InChI |
InChI=1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2+ |
CAS Registry Number |
147-73-9 |
EINECS |
205-696-1 |
Molecular Structure |
|
Density |
1.886g/cm3 |
Melting point |
165-166℃ |
Boiling point |
399.3°C at 760 mmHg |
Refractive index |
1.585 |
Flash point |
209.4°C |
Vapour Pressur |
4.93E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|