| product Name | 
    quinine diascorbate | 
   
  
  
    | Synonyms | 
    Quinine ascorbate [USAN]; L-Ascorbic acid, compound with quinine (2:1); Quinine ascorbate; Quinine biascorbate; L-Ascorbic acid, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (2:1); Quinine diascorbate; (4beta,8alpha,9R)-6'-methoxycinchonan-9-ol - L-threo-hex-1-enofuranos-3-ulose (1:2) | 
   
  
  
  
    | Molecular Formula | 
    C32H40N2O14 | 
   
  
  
  
    | Molecular Weight | 
    676.665 | 
   
  
  
  
    | InChI | 
    InChI=1/C20H24N2O2.2C6H8O6/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;2*7-1-2(8)5-3(9)4(10)6(11)12-5/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*2,5,7-8,10-11H,1H2/t13-,14+,19-,20+;2*2-,5+/m000/s1 | 
   
  
  
  
    | CAS Registry Number | 
    146-40-7 | 
   
  
  
  
    | EINECS | 
    205-671-5 | 
   
  
  
  
    | Molecular Structure | 
     
                 | 
   
  
  
  
  
   
    | Boiling point | 
    495.9°C at 760 mmHg | 
   
  
  
  
  
    | Flash point | 
    253.7°C | 
   
  
  
  
  
    | Vapour Pressur | 
    1.19E-10mmHg at 25°C | 
   
  
  
  
    | Hazard Symbols | 
    
       
       
       
 | 
   
  
  
  
    | Risk Codes | 
    
       
       
       
 | 
   
  
  
  
    | Safety Description | 
    
       
       
       
 | 
   
  
  
 
 |