| product Name |
quinine diascorbate |
| Synonyms |
Quinine ascorbate [USAN]; L-Ascorbic acid, compound with quinine (2:1); Quinine ascorbate; Quinine biascorbate; L-Ascorbic acid, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (2:1); Quinine diascorbate; (4beta,8alpha,9R)-6'-methoxycinchonan-9-ol - L-threo-hex-1-enofuranos-3-ulose (1:2) |
| Molecular Formula |
C32H40N2O14 |
| Molecular Weight |
676.665 |
| InChI |
InChI=1/C20H24N2O2.2C6H8O6/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;2*7-1-2(8)5-3(9)4(10)6(11)12-5/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*2,5,7-8,10-11H,1H2/t13-,14+,19-,20+;2*2-,5+/m000/s1 |
| CAS Registry Number |
146-40-7 |
| EINECS |
205-671-5 |
| Molecular Structure |
|
| Boiling point |
495.9°C at 760 mmHg |
| Flash point |
253.7°C |
| Vapour Pressur |
1.19E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|