| product Name |
2-Ethylbenzeneboronic acid |
| Synonyms |
2-Ethylphenylboronic acid |
| Molecular Formula |
C8H11BO2 |
| Molecular Weight |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3 |
| CAS Registry Number |
90002-36-1 |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Melting point |
102.5-107.5℃ |
| Boiling point |
299.1°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
134.7°C |
| Vapour Pressur |
0.000544mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
