| product Name |
N,N,N'-Trimethyl ethylenediamine |
| Synonyms |
dimethyl(2-(methylamino)ethyl)amine; N,N,N'-trimethylethane-1,2-diamine; N,N,N'-trimethylethane-1,2-diaminium |
| Molecular Formula |
C5H16N2 |
| Molecular Weight |
104.1928 |
| InChI |
InChI=1/C5H14N2/c1-6-4-5-7(2)3/h6H,4-5H2,1-3H3/p+2 |
| CAS Registry Number |
142-25-6 |
| EINECS |
205-529-2 |
| Molecular Structure |
|
| Boiling point |
117°C at 760 mmHg |
| Flash point |
9.4°C |
| Vapour Pressur |
17.8mmHg at 25°C |
| Hazard Symbols |
F:Highly flammable;
C:Corrosive;
|
| Risk Codes |
R11:Highly flammable.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|