| product Name |
3-Iodopropionic acid |
| Synonyms |
Iodopropionicacid; 3-iodopropanoic acid; 3-iodopropanoate |
| Molecular Formula |
C3H4IO2 |
| Molecular Weight |
198.9677 |
| InChI |
InChI=1/C3H5IO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1 |
| CAS Registry Number |
141-76-4 |
| EINECS |
205-499-0 |
| Molecular Structure |
|
| Melting point |
80-85℃ |
| Boiling point |
259.7°C at 760 mmHg |
| Flash point |
110.9°C |
| Vapour Pressur |
0.00383mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
