product Name |
3-Iodopropionic acid |
Synonyms |
Iodopropionicacid; 3-iodopropanoic acid; 3-iodopropanoate |
Molecular Formula |
C3H4IO2 |
Molecular Weight |
198.9677 |
InChI |
InChI=1/C3H5IO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1 |
CAS Registry Number |
141-76-4 |
EINECS |
205-499-0 |
Molecular Structure |
|
Melting point |
80-85℃ |
Boiling point |
259.7°C at 760 mmHg |
Flash point |
110.9°C |
Vapour Pressur |
0.00383mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|