| product Name |
1,3-di-O-tolyl-2-thiourea |
| Synonyms |
Ditolylthiourea; N,N-Di-o-tolylthiourea; N,N-Bis(2-Methylphenyl)thiourea; N,N,N-trimethyl(phenyl)methanaminium bromide; 1,3-bis(2-methylphenyl)thiourea |
| Molecular Formula |
C15H16N2S |
| Molecular Weight |
256.3659 |
| InChI |
InChI=1/C15H16N2S/c1-11-7-3-5-9-13(11)16-15(18)17-14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H2,16,17,18) |
| CAS Registry Number |
137-97-3 |
| EINECS |
205-309-6 |
| Molecular Structure |
|
| Density |
1.219g/cm3 |
| Melting point |
157-159℃ |
| Boiling point |
367.5°C at 760 mmHg |
| Refractive index |
1.707 |
| Flash point |
176°C |
| Vapour Pressur |
1.36E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|