product Name |
Terephthalic dihydrazide |
Synonyms |
Benzene-1,4-dicarboxylic acid dihydrazide; benzene-1,4-dicarbohydrazide |
Molecular Formula |
C8H10N4O2 |
Molecular Weight |
194.1906 |
InChI |
InChI=1/C8H10N4O2/c9-11-7(13)5-1-2-6(4-3-5)8(14)12-10/h1-4H,9-10H2,(H,11,13)(H,12,14) |
CAS Registry Number |
136-64-1 |
EINECS |
205-253-2 |
Molecular Structure |
|
Density |
1.344g/cm3 |
Refractive index |
1.628 |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|