| product Name |
Phenoxazine |
| Synonyms |
Phenoxazine, 99%; 10H-phenoxazine |
| Molecular Formula |
C12H9NO |
| Molecular Weight |
183.206 |
| InChI |
InChI=1/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
| CAS Registry Number |
135-67-1 |
| EINECS |
205-210-8 |
| Molecular Structure |
|
| Density |
1.196g/cm3 |
| Melting point |
154-159℃ |
| Boiling point |
318°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
122.6°C |
| Vapour Pressur |
0.000372mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
