| product Name |
DL-2-(4-chlorophenyl)propan-oic acid |
| Synonyms |
4-chloromethyl phenylacetic acid; 2-(4-chlorophenyl)propanoic acid; [4-(chloromethyl)phenyl]acetic acid; 2-(4-chlorophenyl)propionic acid |
| Molecular Formula |
C9H9ClO2 |
| Molecular Weight |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6H2,(H,11,12) |
| CAS Registry Number |
938-95-4 |
| EINECS |
213-351-1 |
| Molecular Structure |
|
| Density |
1.277g/cm3 |
| Boiling point |
332.2°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
154.7°C |
| Vapour Pressur |
5.91E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
