product Name |
2-(8-Chloro-1-naphthylthio)acetic acid |
Synonyms |
2-[(8-Chloro-1-naphthyl)thio]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetate |
Molecular Formula |
C12H8ClO2S |
Molecular Weight |
251.7093 |
InChI |
InChI=1/C12H9ClO2S/c13-9-5-1-3-8-4-2-6-10(12(8)9)16-7-11(14)15/h1-6H,7H2,(H,14,15)/p-1 |
CAS Registry Number |
129-94-2 |
EINECS |
204-971-3 |
Molecular Structure |
|
Melting point |
155-157℃ |
Boiling point |
450.1°C at 760 mmHg |
Flash point |
226°C |
Vapour Pressur |
6.9E-09mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|