| product Name |
4-iodo-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one |
| Synonyms |
4-iodophenazone; 4-iodoanalgesine; 4-iodo-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one |
| Molecular Formula |
C11H11IN2O |
| Molecular Weight |
314.1223 |
| InChI |
InChI=1/C11H11IN2O/c1-8-10(12)11(15)14(13(8)2)9-6-4-3-5-7-9/h3-7H,1-2H3 |
| CAS Registry Number |
129-81-7 |
| EINECS |
204-966-6 |
| Molecular Structure |
|
| Density |
1.77g/cm3 |
| Boiling point |
325.9°C at 760 mmHg |
| Refractive index |
1.697 |
| Flash point |
150.9°C |
| Vapour Pressur |
0.000223mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
