| 
  
    | product Name | 4-iodo-2,3-dimethyl-1-phenyl-3-pyrazolin-5-one |  
    | Synonyms | 4-iodophenazone; 4-iodoanalgesine; 4-iodo-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one |  
    | Molecular Formula | C11H11IN2O |  
    | Molecular Weight | 314.1223 |  
    | InChI | InChI=1/C11H11IN2O/c1-8-10(12)11(15)14(13(8)2)9-6-4-3-5-7-9/h3-7H,1-2H3 |  
    | CAS Registry Number | 129-81-7 |  
    | EINECS | 204-966-6 |  
    | Molecular Structure |   |  
    | Density | 1.77g/cm3 |  
    | Boiling point | 325.9°C at 760 mmHg |  
    | Refractive index | 1.697 |  
    | Flash point | 150.9°C |  
    | Vapour Pressur | 0.000223mmHg at 25°C |  
    | Hazard Symbols |  |  
    | Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; 
 |  
    | Safety Description | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;
 
 |  |