product Name |
3,5,5-Trimethyloxazolidine-2,4-dione |
Synonyms |
Trimethadione; Troxidone; N-carbamoyl-2-phenylacetamide; 3,5,5-trimethyl-1,3-oxazolidine-2,4-dione |
Molecular Formula |
C6H9NO3 |
Molecular Weight |
143.1406 |
InChI |
InChI=1/C6H9NO3/c1-6(2)4(8)7(3)5(9)10-6/h1-3H3 |
CAS Registry Number |
127-48-0 |
EINECS |
204-845-8 |
Molecular Structure |
|
Density |
1.171g/cm3 |
Melting point |
45-46℃ |
Boiling point |
155.8°C at 760 mmHg |
Refractive index |
1.457 |
Flash point |
48°C |
Vapour Pressur |
2.98mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|