| product Name |
Dichloromethylvinylsilane |
| Synonyms |
Methylvinyldichlorosilane~Vinylmethyldichlorosilane; Vinylmethyldichlorosilane; dichloro(ethenyl)methylsilane; (dichloromethyl)(ethenyl)silane |
| Molecular Formula |
C3H6Cl2Si |
| Molecular Weight |
141.0712 |
| InChI |
InChI=1/C3H6Cl2Si/c1-2-6-3(4)5/h2-3H,1,6H2 |
| CAS Registry Number |
124-70-9 |
| EINECS |
204-710-3 |
| Molecular Structure |
|
| Boiling point |
123.103°C at 760 mmHg |
| Flash point |
28.252°C |
| Vapour Pressur |
16.308mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 C:Corrosive;
|
| Risk Codes |
R11:Highly flammable.;
R14:Reacts violently with water.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
