| product Name |
N-methyl-N-phenylthiourea |
| Synonyms |
1-Methyl-1-phenylthiourea |
| Molecular Formula |
C8H10N2S |
| Molecular Weight |
166.2434 |
| InChI |
InChI=1/C8H10N2S/c1-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
| CAS Registry Number |
4104-75-0 |
| EINECS |
223-877-3 |
| Molecular Structure |
|
| Density |
1.221g/cm3 |
| Melting point |
101℃ |
| Boiling point |
267.1°C at 760 mmHg |
| Refractive index |
1.679 |
| Flash point |
115.3°C |
| Vapour Pressur |
0.00831mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S37/39:Wear suitable gloves and eye/face protection.;
|
|
