| product Name |
1,2,3-thiadiazole-4-carboxamide |
| Synonyms |
- |
| Molecular Formula |
C3H3N3OS |
| Molecular Weight |
129.1404 |
| InChI |
InChI=1/C3H3N3OS/c4-3(7)2-1-8-6-5-2/h1H,(H2,4,7) |
| CAS Registry Number |
4100-20-3 |
| Molecular Structure |
|
| Density |
1.536g/cm3 |
| Melting point |
216℃ |
| Boiling point |
370.2°C at 760 mmHg |
| Refractive index |
1.625 |
| Flash point |
177.7°C |
| Vapour Pressur |
1.12E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
