| product Name |
1-Phenylpyrrolidine |
| Synonyms |
- |
| Molecular Formula |
C10H13N |
| Molecular Weight |
147.2169 |
| InChI |
InChI=1/C10H13N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2 |
| CAS Registry Number |
4096-21-3 |
| EINECS |
223-849-0 |
| Molecular Structure |
|
| Density |
1.022g/cm3 |
| Boiling point |
237.8°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
89°C |
| Vapour Pressur |
0.0439mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
