product Name |
3-(trifluoromethyl)thiophenol |
Synonyms |
3-(Trifluoromethyl)benzenethiol; 1-bromo-5-chloro-2-fluoro-4-methylbenzene |
Molecular Formula |
C7H5BrClF |
Molecular Weight |
223.47 |
InChI |
InChI=1/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3 |
CAS Registry Number |
937-00-8 |
Molecular Structure |
|
Density |
1.618g/cm3 |
Boiling point |
221.1°C at 760 mmHg |
Refractive index |
1.545 |
Flash point |
87.5°C |
Vapour Pressur |
0.162mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|