| product Name |
N,N-Dimethyl-N'-ethylethylenediamine |
| Synonyms |
2-ethylaminoethyldimethylamine; 1-dimethylamino-2-ethylaminoethane; N,N-Dimethyl-N-ethylethylenediamine; N'-ethyl-N,N-dimethylethane-1,2-diamine; N'-ethyl-N,N-dimethylethane-1,2-diaminium |
| Molecular Formula |
C6H18N2 |
| Molecular Weight |
118.2194 |
| InChI |
InChI=1/C6H16N2/c1-4-7-5-6-8(2)3/h7H,4-6H2,1-3H3/p+2 |
| CAS Registry Number |
123-83-1 |
| EINECS |
204-656-0 |
| Molecular Structure |
|
| Boiling point |
134.5°C at 760 mmHg |
| Flash point |
23.9°C |
| Vapour Pressur |
8.06mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R10:Flammable.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
