| product Name |
N,N-Diethyl-N',N'-dimethylethylenediamine |
| Synonyms |
N,N-Diethyl-N,N-dimethylethylene-diamine; N,N-diethyl-N',N'-dimethylethane-1,2-diamine |
| Molecular Formula |
C8H20N2 |
| Molecular Weight |
144.2578 |
| InChI |
InChI=1/C8H20N2/c1-5-10(6-2)8-7-9(3)4/h5-8H2,1-4H3 |
| CAS Registry Number |
123-10-4 |
| EINECS |
204-601-0 |
| Molecular Structure |
|
| Density |
0.823g/cm3 |
| Boiling point |
156.7°C at 760 mmHg |
| Refractive index |
1.444 |
| Flash point |
36.7°C |
| Vapour Pressur |
2.86mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
