| product Name |
N,N'-Bis(2-hydroxyethyl)piperazine |
| Synonyms |
N,N-Piperazinediethanol; 2,2'-piperazine-1,4-diyldiethanol; 1,4-bis(2-hydroxyethyl)piperazinediium; 1,4-bis(2-hydroxyethyl)piperazine |
| Molecular Formula |
C8H20N2O2 |
| Molecular Weight |
176.2555 |
| InChI |
InChI=1/C8H18N2O2/c11-7-5-9-1-2-10(4-3-9)6-8-12/h11-12H,1-8H2/p+2 |
| CAS Registry Number |
122-96-3 |
| EINECS |
204-586-0 |
| Molecular Structure |
|
| Melting point |
134-137℃ |
| Boiling point |
305.7°C at 760 mmHg |
| Flash point |
166.2°C |
| Vapour Pressur |
7.58E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
