| product Name |
Tributylborane |
| Synonyms |
Tributylborane solution; Tri-n-butylborane; Boronbutoxide |
| Molecular Formula |
C12H27B |
| Molecular Weight |
182.1538 |
| InChI |
InChI=1/C12H27B/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3 |
| CAS Registry Number |
122-56-5 |
| EINECS |
204-554-6 |
| Molecular Structure |
|
| Density |
0.732g/cm3 |
| Boiling point |
209°C at 760 mmHg |
| Refractive index |
1.406 |
| Flash point |
94.9°C |
| Vapour Pressur |
0.3mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 C:Corrosive;
|
| Risk Codes |
R11:Highly flammable.;
R17:Spontaneously flammable in air.;
R19:May form explosive peroxides.;
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S33:Take precautionary measures against static discharges.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
