| product Name |
7-Methyladenine |
| Synonyms |
6-Amino-7-methylpurine; 7-methyl-7H-purin-6-amine |
| Molecular Formula |
C6H7N5 |
| Molecular Weight |
149.1533 |
| InChI |
InChI=1/C6H7N5/c1-11-3-10-6-4(11)5(7)8-2-9-6/h2-3H,1H3,(H2,7,8,9) |
| CAS Registry Number |
935-69-3 |
| Molecular Structure |
|
| Density |
1.6g/cm3 |
| Melting point |
323℃ |
| Boiling point |
385.9°C at 760 mmHg |
| Refractive index |
1.807 |
| Flash point |
187.2°C |
| Vapour Pressur |
3.67E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
