| product Name |
4-Chloro-3,5-dinitrobenzoic acid |
| Synonyms |
3,5-Dinitro-4-Chloro Benzoic Acid; 4-C-3,5-DNBA;
; 4-chloro-3,5-dinitrobenzoate |
| Molecular Formula |
C7H2ClN2O6 |
| Molecular Weight |
245.5541 |
| InChI |
InChI=1/C7H3ClN2O6/c8-6-4(9(13)14)1-3(7(11)12)2-5(6)10(15)16/h1-2H,(H,11,12)/p-1 |
| CAS Registry Number |
118-97-8 |
| EINECS |
204-290-1 |
| Molecular Structure |
|
| Melting point |
157-163℃ |
| Boiling point |
422.7°C at 760 mmHg |
| Flash point |
209.4°C |
| Vapour Pressur |
6.73E-08mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S22:;
S24/25:;
|
|