| product Name |
Rhodizonic acid dihydrate |
| Synonyms |
5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetraone; Rhodizonic acid; 1,2-Dihydroxy-3,4,5,6-tetraoxocyclohexene; 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetrone; 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetrone dihydrate |
| Molecular Formula |
C6H6O8 |
| Molecular Weight |
206.107 |
| InChI |
InChI=1/C6H2O6.2H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h7-8H;2*1H2 |
| CAS Registry Number |
118-76-3 |
| EINECS |
204-276-5 |
| Molecular Structure |
|
| Melting point |
255-257℃ |
| Boiling point |
346.7°C at 760 mmHg |
| Flash point |
177.7°C |
| Vapour Pressur |
3.5E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
