| product Name |
etryptamine acetate |
| Synonyms |
ALPHA-Ethyltryptamine acetate; 1-(1H-indol-3-yl)butan-2-amine acetate (1:1); 1-(1H-indol-3-yl)butan-2-amine |
| Molecular Formula |
C12H16N2 |
| Molecular Weight |
188.2688 |
| InChI |
InChI=1/C12H16N2/c1-2-10(13)7-9-8-14-12-6-4-3-5-11(9)12/h3-6,8,10,14H,2,7,13H2,1H3 |
| CAS Registry Number |
118-68-3 |
| EINECS |
204-268-1 |
| Molecular Structure |
|
| Density |
1.096g/cm3 |
| Boiling point |
356.2°C at 760 mmHg |
| Refractive index |
1.626 |
| Flash point |
196.5°C |
| Vapour Pressur |
2.96E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|