| product Name |
Isatoic anhydride |
| Synonyms |
4H-3,1-Benzoxazine-2,4(1H)-dione; 2H-3,1-benzoxazine-2,4(1H)-dione |
| Molecular Formula |
C8H5NO3 |
| Molecular Weight |
163.1302 |
| InChI |
InChI=1/C8H5NO3/c10-7-5-3-1-2-4-6(5)9-8(11)12-7/h1-4H,(H,9,11) |
| CAS Registry Number |
118-48-9 |
| EINECS |
204-255-0 |
| Molecular Structure |
|
| Density |
1.402g/cm3 |
| Melting point |
233℃ |
| Refractive index |
1.585 |
| Water solubility |
decomposes |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36:;
R43:;
|
| Safety Description |
S24:;
S26:;
S37:;
|
|