| product Name |
2-Aminoanthraquinone |
| Synonyms |
β-Aminoanthraquinone; 2-aminoanthracene-9,10-dione |
| Molecular Formula |
C14H9NO2 |
| Molecular Weight |
223.2268 |
| InChI |
InChI=1/C14H9NO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H,15H2 |
| CAS Registry Number |
117-79-3 |
| EINECS |
204-208-4 |
| Molecular Structure |
|
| Density |
1.383g/cm3 |
| Melting point |
292-295℃ |
| Boiling point |
472.9°C at 760 mmHg |
| Refractive index |
1.707 |
| Flash point |
239.8°C |
| Vapour Pressur |
4.12E-09mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R40:;
|
| Safety Description |
S36/37/39:;
|
|