| product Name |
anisindione |
| Synonyms |
2-(4-methoxyphenyl)indan-1,3-dione; 2-(4-methoxyphenyl)-1H-indene-1,3(2H)-dione |
| Molecular Formula |
C16H12O3 |
| Molecular Weight |
252.2647 |
| InChI |
InChI=1/C16H12O3/c1-19-11-8-6-10(7-9-11)14-15(17)12-4-2-3-5-13(12)16(14)18/h2-9,14H,1H3 |
| CAS Registry Number |
117-37-3 |
| EINECS |
204-186-6 |
| Molecular Structure |
|
| Density |
1.263g/cm3 |
| Boiling point |
443.9°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
199.8°C |
| Vapour Pressur |
4.45E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|