| product Name |
1,1'-(2-nitrobutylidene)bis(4-chlorobenzene) |
| Synonyms |
Bulan; 1,1'-(2-Nitrobutylidene)bis(4-chlorobenzene); 1,1-Bis(4-chlorophenyl)-2-nitrobutane; 1,1-Bis(p-chlorophenyl)-2-nitrobutane; 2-Nitro-1,1-bis(p-chlorophenyl)butane; 4-05-00-01944 (Beilstein Handbook Reference); BRN 2509596; Benzene, 1,1'-(2-nitrobutylidene)bis(4-chloro-; Butane, 1,1-bis(p-chlorophenyl)-2-nitro-; CS 674A; Caswell No. 092A; DNB; ENT 18,065; HSDB 1420; 1,1'-(2-nitrobutane-1,1-diyl)bis(4-chlorobenzene) |
| Molecular Formula |
C16H15Cl2NO2 |
| Molecular Weight |
324.2018 |
| InChI |
InChI=1/C16H15Cl2NO2/c1-2-15(19(20)21)16(11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12/h3-10,15-16H,2H2,1H3 |
| CAS Registry Number |
117-26-0 |
| EINECS |
208-431-8 |
| Molecular Structure |
|
| Density |
1.265g/cm3 |
| Boiling point |
444.6°C at 760 mmHg |
| Refractive index |
1.579 |
| Flash point |
222.7°C |
| Vapour Pressur |
4.22E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|