| product Name |
2-(2-chloro-6-methylphenyl)-2,4-dihydro-5-methyl-3H-pyrazol-3-one |
| Synonyms |
3H-Pyrazol-3-one, 2-(2-chloro-6-methylphenyl)-2,4-dihydro-5-methyl-; 2-(2-Chloro-6-methylphenyl)-2,4-dihydro-5-methyl-3H-pyrazol-3-one; 2-(2-chloro-6-methylphenyl)-5-methyl-2,4-dihydro-3H-pyrazol-3-one |
| Molecular Formula |
C11H11ClN2O |
| Molecular Weight |
222.6708 |
| InChI |
InChI=1/C11H11ClN2O/c1-7-4-3-5-9(12)11(7)14-10(15)6-8(2)13-14/h3-5H,6H2,1-2H3 |
| CAS Registry Number |
117-23-7 |
| EINECS |
204-181-9 |
| Molecular Structure |
|
| Density |
1.28g/cm3 |
| Boiling point |
373.7°C at 760 mmHg |
| Refractive index |
1.613 |
| Flash point |
179.8°C |
| Vapour Pressur |
8.81E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|