| product Name |
3-Chlorophthalic anhydride |
| Synonyms |
1,3-Isobenzofurandione, 4-chloro-; CHLORPHTHALIDONE; 4-chloro-2-benzofuran-1,3-dione |
| Molecular Formula |
C8H3ClO3 |
| Molecular Weight |
182.5606 |
| InChI |
InChI=1/C8H3ClO3/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-3H |
| CAS Registry Number |
117-21-5 |
| EINECS |
204-179-8 |
| Molecular Structure |
|
| Density |
1.594g/cm3 |
| Boiling point |
317.2°C at 760 mmHg |
| Refractive index |
1.626 |
| Flash point |
152.2°C |
| Vapour Pressur |
0.000392mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|